About [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate
[(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate (PubChem CID 101123824) has the molecular formula C16H17F3O4
and a molecular weight of 330.30 g/mol. Its IUPAC name is [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate.
Molecular Properties
| Compound Name | [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate |
| PubChem CID | 101123824 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate |
| SMILES | O=C(OC/C=C(/c1ccccc1)C1(O)CCC1)OCC(F)(F)F |
| InChI | InChI=1S/C16H17F3O4/c17-16(18,19)11-23-14(20)22-10-7-13(15(21)8-4-9-15)12-5-2-1-3-6-12/h1-3,5-7,21H,4,8-11H2/b13-7- |
| InChIKey | WTFNLIUECCCGEK-QPEQYQDCSA-N |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate?
The IUPAC name of [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate (CID 101123824) is [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate.
What is the SMILES notation for [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate?
The canonical SMILES for [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate is O=C(OC/C=C(/c1ccccc1)C1(O)CCC1)OCC(F)(F)F.
What is the InChIKey of [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate?
The InChIKey is WTFNLIUECCCGEK-QPEQYQDCSA-N. The full InChI is InChI=1S/C16H17F3O4/c17-16(18,19)11-23-14(20)22-10-7-13(15(21)8-4-9-15)12-5-2-1-3-6-12/h1-3,5-7,21H,4,8-11H2/b13-7-.
What are the key properties of [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate?
[(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate has a molecular weight of 330.30 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-(1-hydroxycyclobutyl)-3-phenylprop-2-enyl] 2,2,2-trifluoroethyl carbonate is sourced from PubChem (CID 101123824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).