C23H21NO — CID 101124325
(2S,5R)-1-(4-methylphenyl)-2,5-diphenylpyrrolidin-3-one (PubChem CID 101124325) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (2S,5R)-1-(4-methylphenyl)-2,5-diphenylpyrrolidin-3-one.
| Compound Name | (2S,5R)-1-(4-methylphenyl)-2,5-diphenylpyrrolidin-3-one |
|---|---|
| PubChem CID | 101124325 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S,5R)-1-(4-methylphenyl)-2,5-diphenylpyrrolidin-3-one |
| SMILES | Cc1ccc(N2[C@@H](c3ccccc3)CC(=O)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-17-12-14-20(15-13-17)24-21(18-8-4-2-5-9-18)16-22(25)23(24)19-10-6-3-7-11-19/h2-15,21,23H,16H2,1H3/t21-,23+/m1/s1 |
| InChIKey | QRLBCEJSCOYKTE-GGAORHGYSA-N |
| XLogP | 5.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |