About tris(prop-2-ynoxy)silane
tris(prop-2-ynoxy)silane (PubChem CID 101124394) has the molecular formula C9H10O3Si
and a molecular weight of 194.26 g/mol. Its IUPAC name is tris(prop-2-ynoxy)silane.
Molecular Properties
| Compound Name | tris(prop-2-ynoxy)silane |
| PubChem CID | 101124394 |
| Molecular Formula | C9H10O3Si |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | tris(prop-2-ynoxy)silane |
| SMILES | C#CCO[SiH](OCC#C)OCC#C |
| InChI | InChI=1S/C9H10O3Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h1-3,13H,7-9H2 |
| InChIKey | WTMHUOMJFADNQF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tris(prop-2-ynoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(prop-2-ynoxy)silane?
The IUPAC name of tris(prop-2-ynoxy)silane (CID 101124394) is tris(prop-2-ynoxy)silane.
What is the SMILES notation for tris(prop-2-ynoxy)silane?
The canonical SMILES for tris(prop-2-ynoxy)silane is C#CCO[SiH](OCC#C)OCC#C.
What is the InChIKey of tris(prop-2-ynoxy)silane?
The InChIKey is WTMHUOMJFADNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h1-3,13H,7-9H2.
What are the key properties of tris(prop-2-ynoxy)silane?
tris(prop-2-ynoxy)silane has a molecular weight of 194.26 g/mol, XLogP of -0.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(prop-2-ynoxy)silane is sourced from PubChem (CID 101124394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).