C31H54O — CID 101124567
(3S,4aR,6aR,6aR,6bR,8aS,11R,12aS,14aR,14bR)-4,4,6a,6b,9,9,11,12a,14b-nonamethyl-1,2,3,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydropicen-3-ol (PubChem CID 101124567) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is (3S,4aR,6aR,6aR,6bR,8aS,11R,12aS,14aR,14bR)-4,4,6a,6b,9,9,11,12a,14b-nonamethyl-1,2,3,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydropicen-3-ol.
| Compound Name | (3S,4aR,6aR,6aR,6bR,8aS,11R,12aS,14aR,14bR)-4,4,6a,6b,9,9,11,12a,14b-nonamethyl-1,2,3,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydropicen-3-ol |
|---|---|
| PubChem CID | 101124567 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | (3S,4aR,6aR,6aR,6bR,8aS,11R,12aS,14aR,14bR)-4,4,6a,6b,9,9,11,12a,14b-nonamethyl-1,2,3,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydropicen-3-ol |
| SMILES | C[C@@H]1CC(C)(C)[C@@H]2CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@]2(C)C1 |
| InChI | InChI=1S/C31H54O/c1-20-18-26(2,3)21-12-16-31(9)24(29(21,7)19-20)11-10-23-28(6)15-14-25(32)27(4,5)22(28)13-17-30(23,31)8/h20-25,32H,10-19H2,1-9H3/t20-,21+,22+,23-,24-,25+,28+,29+,30-,31-/m1/s1 |
| InChIKey | IRUAZLSVSAWHSS-GDKFKXPASA-N |
| XLogP | 8.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |