C11H19N — CID 101124615
(2S,8S)-2-but-3-enyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 101124615) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2S,8S)-2-but-3-enyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | (2S,8S)-2-but-3-enyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 101124615 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2S,8S)-2-but-3-enyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C=CCC[C@H]1C[C@@H]2CCCN2C1 |
| InChI | InChI=1S/C11H19N/c1-2-3-5-10-8-11-6-4-7-12(11)9-10/h2,10-11H,1,3-9H2/t10-,11-/m0/s1 |
| InChIKey | ADMRZYTVNALKER-QWRGUYRKSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|