C22H22N4O2 — CID 101124759
(1S,2S,8R)-2,3-dimethyl-5-(4-methylphenyl)-10-phenyl-4,5,6,10-tetrazatricyclo[6.3.0.02,6]undec-3-ene-9,11-dione (PubChem CID 101124759) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is (1S,2S,8R)-2,3-dimethyl-5-(4-methylphenyl)-10-phenyl-4,5,6,10-tetrazatricyclo[6.3.0.02,6]undec-3-ene-9,11-dione.
| Compound Name | (1S,2S,8R)-2,3-dimethyl-5-(4-methylphenyl)-10-phenyl-4,5,6,10-tetrazatricyclo[6.3.0.02,6]undec-3-ene-9,11-dione |
|---|---|
| PubChem CID | 101124759 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,2S,8R)-2,3-dimethyl-5-(4-methylphenyl)-10-phenyl-4,5,6,10-tetrazatricyclo[6.3.0.02,6]undec-3-ene-9,11-dione |
| SMILES | CC1=NN(c2ccc(C)cc2)N2C[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@@]12C |
| InChI | InChI=1S/C22H22N4O2/c1-14-9-11-17(12-10-14)26-23-15(2)22(3)19-18(13-24(22)26)20(27)25(21(19)28)16-7-5-4-6-8-16/h4-12,18-19H,13H2,1-3H3/t18-,19+,22+/m0/s1 |
| InChIKey | GVOYVLGERORRLQ-NNMXDRDESA-N |
| XLogP | 2.99 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|