C19H14N2O4 — CID 101124983
(9R,10R,14S)-12-methyl-9-phenyl-15-oxa-1,12-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,11,13-trione (PubChem CID 101124983) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is (9R,10R,14S)-12-methyl-9-phenyl-15-oxa-1,12-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,11,13-trione.
| Compound Name | (9R,10R,14S)-12-methyl-9-phenyl-15-oxa-1,12-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,11,13-trione |
|---|---|
| PubChem CID | 101124983 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (9R,10R,14S)-12-methyl-9-phenyl-15-oxa-1,12-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8,11,13-trione |
| SMILES | CN1C(=O)[C@H]2ON3c4ccccc4C(=O)[C@]3(c3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C19H14N2O4/c1-20-17(23)14-15(18(20)24)25-21-13-10-6-5-9-12(13)16(22)19(14,21)11-7-3-2-4-8-11/h2-10,14-15H,1H3/t14-,15+,19+/m1/s1 |
| InChIKey | DBAPQSMZBRBMGQ-VCBZYWHSSA-N |
| XLogP | 1.51 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|