C37H40O12P4 — CID 101125084
9-phenoxy-3-[4-[2-[4-[(9-phenoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]phenyl]propan-2-yl]phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 101125084) has the molecular formula C37H40O12P4 and a molecular weight of 800.61 g/mol. Its IUPAC name is 9-phenoxy-3-[4-[2-[4-[(9-phenoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]phenyl]propan-2-yl]phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 9-phenoxy-3-[4-[2-[4-[(9-phenoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]phenyl]propan-2-yl]phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 101125084 |
| Molecular Formula | C37H40O12P4 |
| Molecular Weight | 800.61 g/mol |
| Exact Mass | 800.15 |
| IUPAC Name | 9-phenoxy-3-[4-[2-[4-[(9-phenoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]phenyl]propan-2-yl]phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(C)(c1ccc(OP2OCC3(COP(Oc4ccccc4)OC3)CO2)cc1)c1ccc(OP2OCC3(COP(Oc4ccccc4)OC3)CO2)cc1 |
| InChI | InChI=1S/C37H40O12P4/c1-35(2,29-13-17-33(18-14-29)48-52-42-25-36(26-43-52)21-38-50(39-22-36)46-31-9-5-3-6-10-31)30-15-19-34(20-16-30)49-53-44-27-37(28-45-53)23-40-51(41-24-37)47-32-11-7-4-8-12-32/h3-20H,21-28H2,1-2H3 |
| InChIKey | KAPTVYKGBXYHSV-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.61 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|