About 4-methyl-4,6-diphenylhex-5-yn-2-one
4-methyl-4,6-diphenylhex-5-yn-2-one (PubChem CID 101125252) has the molecular formula C19H18O
and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-methyl-4,6-diphenylhex-5-yn-2-one.
Molecular Properties
| Compound Name | 4-methyl-4,6-diphenylhex-5-yn-2-one |
| PubChem CID | 101125252 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-methyl-4,6-diphenylhex-5-yn-2-one |
| SMILES | CC(=O)CC(C)(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O/c1-16(20)15-19(2,18-11-7-4-8-12-18)14-13-17-9-5-3-6-10-17/h3-12H,15H2,1-2H3 |
| InChIKey | OWWSVNVYGHKETJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4,6-diphenylhex-5-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4,6-diphenylhex-5-yn-2-one?
The IUPAC name of 4-methyl-4,6-diphenylhex-5-yn-2-one (CID 101125252) is 4-methyl-4,6-diphenylhex-5-yn-2-one.
What is the SMILES notation for 4-methyl-4,6-diphenylhex-5-yn-2-one?
The canonical SMILES for 4-methyl-4,6-diphenylhex-5-yn-2-one is CC(=O)CC(C)(C#Cc1ccccc1)c1ccccc1.
What is the InChIKey of 4-methyl-4,6-diphenylhex-5-yn-2-one?
The InChIKey is OWWSVNVYGHKETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O/c1-16(20)15-19(2,18-11-7-4-8-12-18)14-13-17-9-5-3-6-10-17/h3-12H,15H2,1-2H3.
What are the key properties of 4-methyl-4,6-diphenylhex-5-yn-2-one?
4-methyl-4,6-diphenylhex-5-yn-2-one has a molecular weight of 262.35 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,6-diphenylhex-5-yn-2-one is sourced from PubChem (CID 101125252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).