C16H22O2 — CID 101125832
[(R)-cyclohexen-1-yl(ethoxymethoxy)methyl]benzene (PubChem CID 101125832) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is [(R)-cyclohexen-1-yl(ethoxymethoxy)methyl]benzene.
| Compound Name | [(R)-cyclohexen-1-yl(ethoxymethoxy)methyl]benzene |
|---|---|
| PubChem CID | 101125832 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | [(R)-cyclohexen-1-yl(ethoxymethoxy)methyl]benzene |
| SMILES | CCOCO[C@H](C1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H22O2/c1-2-17-13-18-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3,5-6,9-11,16H,2,4,7-8,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | SYQYGAYOZDFLIT-INIZCTEOSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|