C12H18N4O2S2 — CID 101125894
prop-2-enyl (2S,4S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 101125894) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101125894 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](S)C[C@H]1CSc1nncn1C |
| InChI | InChI=1S/C12H18N4O2S2/c1-3-4-18-12(17)16-6-10(19)5-9(16)7-20-11-14-13-8-15(11)2/h3,8-10,19H,1,4-7H2,2H3/t9-,10-/m0/s1 |
| InChIKey | RUJOYMUKEITCTB-UWVGGRQHSA-N |
| XLogP | 1.60 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|