About [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate
[3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate (PubChem CID 10112593) has the molecular formula C20H20N2O6S
and a molecular weight of 416.46 g/mol. Its IUPAC name is [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate |
| PubChem CID | 10112593 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate |
| SMILES | O=Cc1ccc(-c2ccc(N3CC(COC(=O)N4CCOCC4)OC3=O)s2)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c23-12-14-1-3-15(4-2-14)17-5-6-18(29-17)22-11-16(28-20(22)25)13-27-19(24)21-7-9-26-10-8-21/h1-6,12,16H,7-11,13H2 |
| InChIKey | QHFHOSLSEHOAGZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate?
The IUPAC name of [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate (CID 10112593) is [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate.
What is the SMILES notation for [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate?
The canonical SMILES for [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate is O=Cc1ccc(-c2ccc(N3CC(COC(=O)N4CCOCC4)OC3=O)s2)cc1.
What is the InChIKey of [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate?
The InChIKey is QHFHOSLSEHOAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O6S/c23-12-14-1-3-15(4-2-14)17-5-6-18(29-17)22-11-16(28-20(22)25)13-27-19(24)21-7-9-26-10-8-21/h1-6,12,16H,7-11,13H2.
What are the key properties of [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate?
[3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate has a molecular weight of 416.46 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(4-formylphenyl)thiophen-2-yl]-2-oxo-1,3-oxazolidin-5-yl]methyl morpholine-4-carboxylate is sourced from PubChem (CID 10112593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).