C20H23BrN2O2S — CID 101126088
1-[(4-bromophenyl)methyl]-6-methylsulfonyl-2-pentylbenzimidazole (PubChem CID 101126088) has the molecular formula C20H23BrN2O2S and a molecular weight of 435.39 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-6-methylsulfonyl-2-pentylbenzimidazole.
| Compound Name | 1-[(4-bromophenyl)methyl]-6-methylsulfonyl-2-pentylbenzimidazole |
|---|---|
| PubChem CID | 101126088 |
| Molecular Formula | C20H23BrN2O2S |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-6-methylsulfonyl-2-pentylbenzimidazole |
| SMILES | CCCCCc1nc2ccc(S(C)(=O)=O)cc2n1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23BrN2O2S/c1-3-4-5-6-20-22-18-12-11-17(26(2,24)25)13-19(18)23(20)14-15-7-9-16(21)10-8-15/h7-13H,3-6,14H2,1-2H3 |
| InChIKey | FFTYCAJPPMWWBB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|