C16H16O5S — CID 101126121
(1R,2S,5R,6R,7S)-6-(benzenesulfonyl)-5-methoxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 101126121) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is (1R,2S,5R,6R,7S)-6-(benzenesulfonyl)-5-methoxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,5R,6R,7S)-6-(benzenesulfonyl)-5-methoxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 101126121 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (1R,2S,5R,6R,7S)-6-(benzenesulfonyl)-5-methoxy-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CO[C@@H]1OC(=O)[C@@H]2[C@H]3C=C[C@H](C3)[C@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O5S/c1-20-15-16(22(18,19)12-5-3-2-4-6-12)11-8-7-10(9-11)13(16)14(17)21-15/h2-8,10-11,13,15H,9H2,1H3/t10-,11+,13-,15+,16+/m0/s1 |
| InChIKey | RMYPEUMHCVLBSG-BOOVAVIHSA-N |
| XLogP | 1.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|