About CID 101126253
CID 101126253 (PubChem CID 101126253) has the molecular formula C60H66N6O4
and a molecular weight of 935.23 g/mol.
Molecular Properties
| Compound Name | CID 101126253 |
| PubChem CID | 101126253 |
| Molecular Formula | C60H66N6O4 |
| Molecular Weight | 935.23 g/mol |
| Exact Mass | 934.51 |
| IUPAC Name | — |
| SMILES | Cc1cc2cc(C)c1NC(=O)c1cccc(n1)C(=O)Nc1c(C)cc(cc1C)C1(CCCC(C)C1)c1cc(C)c(c(C)c1)NC(=O)c1cccc(n1)C(=O)Nc1c(C)cc(cc1C)C21CCCC(C)C1 |
| InChI | InChI=1S/C60H66N6O4/c1-33-15-13-21-59(31-33)43-23-35(3)51(36(4)24-43)63-55(67)47-17-11-19-49(61-47)57(69)65-53-39(7)27-45(28-40(53)8)60(22-14-16-34(2)32-60)46-29-41(9)54(42(10)30-46)66-58(70)50-20-12-18-48(62-50)56(68)64-52-37(5)25-44(59)26-38(52)6/h11-12,17-20,23-30,33-34H,13-16,21-22,31-32H2,1-10H3,(H,63,67)(H,64,68)(H,65,69)(H,66,70) |
| InChIKey | WRXCTDXSCQXKBV-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 935.23 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 101126253 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101126253?
The IUPAC name of CID 101126253 (CID 101126253) is not available.
What is the SMILES notation for CID 101126253?
The canonical SMILES for CID 101126253 is Cc1cc2cc(C)c1NC(=O)c1cccc(n1)C(=O)Nc1c(C)cc(cc1C)C1(CCCC(C)C1)c1cc(C)c(c(C)c1)NC(=O)c1cccc(n1)C(=O)Nc1c(C)cc(cc1C)C21CCCC(C)C1.
What is the InChIKey of CID 101126253?
The InChIKey is WRXCTDXSCQXKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H66N6O4/c1-33-15-13-21-59(31-33)43-23-35(3)51(36(4)24-43)63-55(67)47-17-11-19-49(61-47)57(69)65-53-39(7)27-45(28-40(53)8)60(22-14-16-34(2)32-60)46-29-41(9)54(42(10)30-46)66-58(70)50-20-12-18-48(62-50)56(68)64-52-37(5)25-44(59)26-38(52)6/h11-12,17-20,23-30,33-34H,13-16,21-22,31-32H2,1-10H3,(H,63,67)(H,64,68)(H,65,69)(H,66,70).
What are the key properties of CID 101126253?
CID 101126253 has a molecular weight of 935.23 g/mol, XLogP of 13.26, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101126253 is sourced from PubChem (CID 101126253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).