C29H52O3Si — CID 101126592
[(3S)-5-[(3aR,5aS,9bS)-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-5-yl]-3-methylpent-1-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101126592) has the molecular formula C29H52O3Si and a molecular weight of 476.82 g/mol. Its IUPAC name is [(3S)-5-[(3aR,5aS,9bS)-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-5-yl]-3-methylpent-1-en-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S)-5-[(3aR,5aS,9bS)-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-5-yl]-3-methylpent-1-en-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101126592 |
| Molecular Formula | C29H52O3Si |
| Molecular Weight | 476.82 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | [(3S)-5-[(3aR,5aS,9bS)-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-5-yl]-3-methylpent-1-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@](C)(CCC1=C(C)[C@H]2OC(C)(C)O[C@H]2C2C(C)(C)CCC[C@]12C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H52O3Si/c1-14-28(10,32-33(12,13)25(3,4)5)19-16-21-20(2)22-23(31-27(8,9)30-22)24-26(6,7)17-15-18-29(21,24)11/h14,22-24H,1,15-19H2,2-13H3/t22-,23-,24?,28-,29-/m1/s1 |
| InChIKey | KDBHJQCQJUJUPN-FFAACTQXSA-N |
| XLogP | 8.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.82 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|