About N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide
N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide (PubChem CID 101126712) has the molecular formula C19H20N4O
and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide |
| PubChem CID | 101126712 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4O/c1-19(2,3)18(24)20-17-16(14-10-6-4-7-11-14)21-23(22-17)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,20,22,24) |
| InChIKey | AGQVJDCFWQQHFE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide (CID 101126712) is N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1nn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide?
The InChIKey is AGQVJDCFWQQHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O/c1-19(2,3)18(24)20-17-16(14-10-6-4-7-11-14)21-23(22-17)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,20,22,24).
What are the key properties of N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide?
N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide has a molecular weight of 320.40 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-diphenyltriazol-4-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 101126712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).