About 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene
1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene (PubChem CID 101127360) has the molecular formula C10H11Cl3O3
and a molecular weight of 285.55 g/mol. Its IUPAC name is 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene.
Molecular Properties
| Compound Name | 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene |
| PubChem CID | 101127360 |
| Molecular Formula | C10H11Cl3O3 |
| Molecular Weight | 285.55 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene |
| SMILES | COc1c(Cl)c(CCl)c(Cl)c(OC)c1OC |
| InChI | InChI=1S/C10H11Cl3O3/c1-14-8-6(12)5(4-11)7(13)9(15-2)10(8)16-3/h4H2,1-3H3 |
| InChIKey | WCORYRCJOUTTJR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene?
The IUPAC name of 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene (CID 101127360) is 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene.
What is the SMILES notation for 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene?
The canonical SMILES for 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene is COc1c(Cl)c(CCl)c(Cl)c(OC)c1OC.
What is the InChIKey of 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene?
The InChIKey is WCORYRCJOUTTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl3O3/c1-14-8-6(12)5(4-11)7(13)9(15-2)10(8)16-3/h4H2,1-3H3.
What are the key properties of 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene?
1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene has a molecular weight of 285.55 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-2-(chloromethyl)-4,5,6-trimethoxybenzene is sourced from PubChem (CID 101127360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).