C15H16O7 — CID 101127474
5-[(2S)-2-hydroxy-3-(2,4,6-trihydroxyphenyl)propyl]benzene-1,2,3-triol (PubChem CID 101127474) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is 5-[(2S)-2-hydroxy-3-(2,4,6-trihydroxyphenyl)propyl]benzene-1,2,3-triol.
| Compound Name | 5-[(2S)-2-hydroxy-3-(2,4,6-trihydroxyphenyl)propyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 101127474 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-[(2S)-2-hydroxy-3-(2,4,6-trihydroxyphenyl)propyl]benzene-1,2,3-triol |
| SMILES | Oc1cc(O)c(C[C@@H](O)Cc2cc(O)c(O)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C15H16O7/c16-8(1-7-2-13(20)15(22)14(21)3-7)4-10-11(18)5-9(17)6-12(10)19/h2-3,5-6,8,16-22H,1,4H2/t8-/m0/s1 |
| InChIKey | IOMNRWRTECGFQZ-QMMMGPOBSA-N |
| XLogP | 1.07 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|