C26H30N2O3 — CID 10112749
(3S,4R)-1-[3-benzyl-4-[2-[(3R)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenyl]pyrrolidine-3,4-diol (PubChem CID 10112749) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is (3S,4R)-1-[3-benzyl-4-[2-[(3R)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[3-benzyl-4-[2-[(3R)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 10112749 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (3S,4R)-1-[3-benzyl-4-[2-[(3R)-3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl]ethynyl]phenyl]pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(c2ccc(C#C[C@@]3(O)CN4CCC3CC4)c(Cc3ccccc3)c2)C[C@@H]1O |
| InChI | InChI=1S/C26H30N2O3/c29-24-16-28(17-25(24)30)23-7-6-20(21(15-23)14-19-4-2-1-3-5-19)8-11-26(31)18-27-12-9-22(26)10-13-27/h1-7,15,22,24-25,29-31H,9-10,12-14,16-18H2/t24-,25+,26-/m1/s1 |
| InChIKey | VEPNPXZFTZLUAQ-UODIDJSMSA-N |
| XLogP | 1.63 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|