C26H34N4O — CID 10112758
11-cyclobutyl-10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 10112758) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 11-cyclobutyl-10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 11-cyclobutyl-10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 10112758 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 11-cyclobutyl-10-(4-methoxy-2-methylphenyl)-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(OC)cc4C)c(C4CCC4)nn13)CCC2 |
| InChI | InChI=1S/C26H34N4O/c1-5-18(6-2)27-25-21-11-8-12-22(21)28-26-23(20-14-13-19(31-4)15-16(20)3)24(29-30(25)26)17-9-7-10-17/h13-15,17-18,27H,5-12H2,1-4H3 |
| InChIKey | JCYYMKXKOHMNFK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |