About dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate
dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate (PubChem CID 101128127) has the molecular formula C14H24O4Si
and a molecular weight of 284.43 g/mol. Its IUPAC name is dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate |
| PubChem CID | 101128127 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate |
| SMILES | COC(=O)C(C)(CC=C=CC[Si](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H24O4Si/c1-14(12(15)17-2,13(16)18-3)10-8-7-9-11-19(4,5)6/h8-9H,10-11H2,1-6H3 |
| InChIKey | VIXDVRFGPBTOTJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate?
The IUPAC name of dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate (CID 101128127) is dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate.
What is the SMILES notation for dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate?
The canonical SMILES for dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate is COC(=O)C(C)(CC=C=CC[Si](C)(C)C)C(=O)OC.
What is the InChIKey of dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate?
The InChIKey is VIXDVRFGPBTOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4Si/c1-14(12(15)17-2,13(16)18-3)10-8-7-9-11-19(4,5)6/h8-9H,10-11H2,1-6H3.
What are the key properties of dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate?
dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate has a molecular weight of 284.43 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-methyl-2-(5-trimethylsilylpenta-2,3-dienyl)propanedioate is sourced from PubChem (CID 101128127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).