About CID 101128275
CID 101128275 (PubChem CID 101128275) has the molecular formula C15H14O2-
and a molecular weight of 226.28 g/mol.
Molecular Properties
| Compound Name | CID 101128275 |
| PubChem CID | 101128275 |
| Molecular Formula | C15H14O2- |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | — |
| SMILES | CC(C)([C]1C=CC(=O)C=C1)c1ccc([O-])cc1 |
| InChI | InChI=1S/C15H15O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16H,1-2H3/p-1 |
| InChIKey | SJDQKKLBQTZIGW-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 101128275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101128275?
The IUPAC name of CID 101128275 (CID 101128275) is not available.
What is the SMILES notation for CID 101128275?
The canonical SMILES for CID 101128275 is CC(C)([C]1C=CC(=O)C=C1)c1ccc([O-])cc1.
What is the InChIKey of CID 101128275?
The InChIKey is SJDQKKLBQTZIGW-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16H,1-2H3/p-1.
What are the key properties of CID 101128275?
CID 101128275 has a molecular weight of 226.28 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101128275 is sourced from PubChem (CID 101128275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).