About 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid
1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid (PubChem CID 101128798) has the molecular formula C30H35N2O4+
and a molecular weight of 487.62 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid.
Molecular Properties
| Compound Name | 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
| PubChem CID | 101128798 |
| Molecular Formula | C30H35N2O4+ |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid |
| SMILES | COCCN1C(c2ccccc2)=[N+](CCOC)C(c2ccc(C)cc2)C1(C(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-22-10-14-24(15-11-22)27-30(29(33)34,26-16-12-23(2)13-17-26)32(19-21-36-4)28(31(27)18-20-35-3)25-8-6-5-7-9-25/h5-17,27H,18-21H2,1-4H3/p+1 |
| InChIKey | KWUKSVIVXVFFLS-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 62.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid?
The IUPAC name of 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid (CID 101128798) is 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid.
What is the SMILES notation for 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid?
The canonical SMILES for 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid is COCCN1C(c2ccccc2)=[N+](CCOC)C(c2ccc(C)cc2)C1(C(=O)O)c1ccc(C)cc1.
What is the InChIKey of 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid?
The InChIKey is KWUKSVIVXVFFLS-UHFFFAOYSA-O. The full InChI is InChI=1S/C30H34N2O4/c1-22-10-14-24(15-11-22)27-30(29(33)34,26-16-12-23(2)13-17-26)32(19-21-36-4)28(31(27)18-20-35-3)25-8-6-5-7-9-25/h5-17,27H,18-21H2,1-4H3/p+1.
What are the key properties of 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid?
1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid has a molecular weight of 487.62 g/mol, XLogP of 4.39, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2-methoxyethyl)-4,5-bis(4-methylphenyl)-2-phenyl-4H-imidazol-3-ium-5-carboxylic acid is sourced from PubChem (CID 101128798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).