C11H14O6 — CID 101129271
[(3S,4S)-4-hydroxy-5-oxooxolan-3-yl]methyl (E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoate (PubChem CID 101129271) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is [(3S,4S)-4-hydroxy-5-oxooxolan-3-yl]methyl (E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoate.
| Compound Name | [(3S,4S)-4-hydroxy-5-oxooxolan-3-yl]methyl (E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101129271 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | [(3S,4S)-4-hydroxy-5-oxooxolan-3-yl]methyl (E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoate |
| SMILES | C[C@H]1O[C@H]1/C=C/C(=O)OC[C@H]1COC(=O)[C@H]1O |
| InChI | InChI=1S/C11H14O6/c1-6-8(17-6)2-3-9(12)15-4-7-5-16-11(14)10(7)13/h2-3,6-8,10,13H,4-5H2,1H3/b3-2+/t6-,7+,8+,10+/m1/s1 |
| InChIKey | MDZROSJVVHMKCB-IHPZTQSASA-N |
| XLogP | -0.59 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|