About (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one
(4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one (PubChem CID 101129355) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one.
Molecular Properties
| Compound Name | (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one |
| PubChem CID | 101129355 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(C(C)C)=C[C@@]2(C)O |
| InChI | InChI=1S/C15H18O2/c1-9(2)12-8-15(4,17)13-6-5-10(3)7-11(13)14(12)16/h5-9,17H,1-4H3/t15-/m1/s1 |
| InChIKey | CNZCFICJJNMIPR-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one?
The IUPAC name of (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one (CID 101129355) is (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one.
What is the SMILES notation for (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one?
The canonical SMILES for (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one is Cc1ccc2c(c1)C(=O)C(C(C)C)=C[C@@]2(C)O.
What is the InChIKey of (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one?
The InChIKey is CNZCFICJJNMIPR-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H18O2/c1-9(2)12-8-15(4,17)13-6-5-10(3)7-11(13)14(12)16/h5-9,17H,1-4H3/t15-/m1/s1.
What are the key properties of (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one?
(4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one has a molecular weight of 230.31 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxy-4,7-dimethyl-2-propan-2-ylnaphthalen-1-one is sourced from PubChem (CID 101129355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).