C16H24O8 — CID 101129492
prop-2-enyl (E)-2-oxo-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]but-3-enoate (PubChem CID 101129492) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is prop-2-enyl (E)-2-oxo-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]but-3-enoate.
| Compound Name | prop-2-enyl (E)-2-oxo-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]but-3-enoate |
|---|---|
| PubChem CID | 101129492 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | prop-2-enyl (E)-2-oxo-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetramethoxyoxan-2-yl]but-3-enoate |
| SMILES | C=CCOC(=O)C(=O)/C=C/[C@@H]1O[C@@H](OC)[C@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C16H24O8/c1-6-9-23-15(18)10(17)7-8-11-12(19-2)13(20-3)14(21-4)16(22-5)24-11/h6-8,11-14,16H,1,9H2,2-5H3/b8-7+/t11-,12-,13+,14+,16+/m0/s1 |
| InChIKey | DZPXSGKWGRRMOF-WULUZNOVSA-N |
| XLogP | 0.26 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|