C22H34O8 — CID 101130213
ethyl 2-[(1R,3S,5S,6R,8S,10S,11R,13S,17S)-5-hydroxy-5,10,17-trimethyl-15-oxo-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-6-yl]acetate (PubChem CID 101130213) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl 2-[(1R,3S,5S,6R,8S,10S,11R,13S,17S)-5-hydroxy-5,10,17-trimethyl-15-oxo-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-6-yl]acetate.
| Compound Name | ethyl 2-[(1R,3S,5S,6R,8S,10S,11R,13S,17S)-5-hydroxy-5,10,17-trimethyl-15-oxo-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-6-yl]acetate |
|---|---|
| PubChem CID | 101130213 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | ethyl 2-[(1R,3S,5S,6R,8S,10S,11R,13S,17S)-5-hydroxy-5,10,17-trimethyl-15-oxo-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1O[C@H]2C[C@H](C)[C@H]3O[C@H]4CC(=O)O[C@@]4(C)CC[C@H]3O[C@H]2C[C@]1(C)O |
| InChI | InChI=1S/C22H34O8/c1-5-26-18(23)9-16-21(3,25)11-15-14(28-16)8-12(2)20-13(27-15)6-7-22(4)17(29-20)10-19(24)30-22/h12-17,20,25H,5-11H2,1-4H3/t12-,13+,14-,15-,16+,17-,20+,21-,22-/m0/s1 |
| InChIKey | NZBBCUDIKCJXDX-CXAKECIOSA-N |
| XLogP | 1.89 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |