C10H16O3 — CID 101130592
(2R,3S,4aR,8aS)-2-ethenyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol (PubChem CID 101130592) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (2R,3S,4aR,8aS)-2-ethenyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol.
| Compound Name | (2R,3S,4aR,8aS)-2-ethenyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol |
|---|---|
| PubChem CID | 101130592 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2R,3S,4aR,8aS)-2-ethenyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-ol |
| SMILES | C=C[C@H]1O[C@H]2CCCO[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C10H16O3/c1-2-8-7(11)6-10-9(13-8)4-3-5-12-10/h2,7-11H,1,3-6H2/t7-,8+,9-,10+/m0/s1 |
| InChIKey | DEOYCJOWQNGDLQ-QCLAVDOMSA-N |
| XLogP | 0.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|