C21H22ClNO2S — CID 101130664
(1E,3E)-N-but-3-enyl-N-[(4-chlorophenyl)methyl]-4-phenylbuta-1,3-diene-1-sulfonamide (PubChem CID 101130664) has the molecular formula C21H22ClNO2S and a molecular weight of 387.93 g/mol. Its IUPAC name is (1E,3E)-N-but-3-enyl-N-[(4-chlorophenyl)methyl]-4-phenylbuta-1,3-diene-1-sulfonamide.
| Compound Name | (1E,3E)-N-but-3-enyl-N-[(4-chlorophenyl)methyl]-4-phenylbuta-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 101130664 |
| Molecular Formula | C21H22ClNO2S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (1E,3E)-N-but-3-enyl-N-[(4-chlorophenyl)methyl]-4-phenylbuta-1,3-diene-1-sulfonamide |
| SMILES | C=CCCN(Cc1ccc(Cl)cc1)S(=O)(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO2S/c1-2-3-16-23(18-20-12-14-21(22)15-13-20)26(24,25)17-8-7-11-19-9-5-4-6-10-19/h2,4-15,17H,1,3,16,18H2/b11-7+,17-8+ |
| InChIKey | CBWXCRBTVYGLTN-CUUDWAJESA-N |
| XLogP | 5.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|