C21H22ClNO2S — CID 101130677
(4aR,6S,8aR)-2-[(4-chlorophenyl)methyl]-6-phenyl-3,4,4a,5,6,8a-hexahydro-1λ6,2-benzothiazine 1,1-dioxide (PubChem CID 101130677) has the molecular formula C21H22ClNO2S and a molecular weight of 387.93 g/mol. Its IUPAC name is (4aR,6S,8aR)-2-[(4-chlorophenyl)methyl]-6-phenyl-3,4,4a,5,6,8a-hexahydro-1λ6,2-benzothiazine 1,1-dioxide.
| Compound Name | (4aR,6S,8aR)-2-[(4-chlorophenyl)methyl]-6-phenyl-3,4,4a,5,6,8a-hexahydro-1λ6,2-benzothiazine 1,1-dioxide |
|---|---|
| PubChem CID | 101130677 |
| Molecular Formula | C21H22ClNO2S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (4aR,6S,8aR)-2-[(4-chlorophenyl)methyl]-6-phenyl-3,4,4a,5,6,8a-hexahydro-1λ6,2-benzothiazine 1,1-dioxide |
| SMILES | O=S1(=O)[C@H]2C=C[C@@H](c3ccccc3)C[C@@H]2CCN1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO2S/c22-20-9-6-16(7-10-20)15-23-13-12-19-14-18(17-4-2-1-3-5-17)8-11-21(19)26(23,24)25/h1-11,18-19,21H,12-15H2/t18-,19+,21+/m1/s1 |
| InChIKey | RLTLQNWAGRUYLC-DYXWJJEUSA-N |
| XLogP | 4.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|