C9H14S2 — CID 101130720
2-(cyclopenten-1-yl)-1,3-dithiane (PubChem CID 101130720) has the molecular formula C9H14S2 and a molecular weight of 186.34 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-1,3-dithiane.
| Compound Name | 2-(cyclopenten-1-yl)-1,3-dithiane |
|---|---|
| PubChem CID | 101130720 |
| Molecular Formula | C9H14S2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-(cyclopenten-1-yl)-1,3-dithiane |
| SMILES | C1=C(C2SCCCS2)CCC1 |
| InChI | InChI=1S/C9H14S2/c1-2-5-8(4-1)9-10-6-3-7-11-9/h4,9H,1-3,5-7H2 |
| InChIKey | YJUUENXFKYOOHY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|