C29H38N2O5Si — CID 101130988
2-[(2S,5S,6R)-4-oxo-6-phenyl-2-[(1S)-1-tri(propan-2-yl)silyloxyethyl]-1,3-oxazinan-5-yl]isoindole-1,3-dione (PubChem CID 101130988) has the molecular formula C29H38N2O5Si and a molecular weight of 522.72 g/mol. Its IUPAC name is 2-[(2S,5S,6R)-4-oxo-6-phenyl-2-[(1S)-1-tri(propan-2-yl)silyloxyethyl]-1,3-oxazinan-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,5S,6R)-4-oxo-6-phenyl-2-[(1S)-1-tri(propan-2-yl)silyloxyethyl]-1,3-oxazinan-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101130988 |
| Molecular Formula | C29H38N2O5Si |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 2-[(2S,5S,6R)-4-oxo-6-phenyl-2-[(1S)-1-tri(propan-2-yl)silyloxyethyl]-1,3-oxazinan-5-yl]isoindole-1,3-dione |
| SMILES | CC(C)[Si](O[C@@H](C)[C@H]1NC(=O)[C@@H](N2C(=O)c3ccccc3C2=O)[C@@H](c2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H38N2O5Si/c1-17(2)37(18(3)4,19(5)6)36-20(7)27-30-26(32)24(25(35-27)21-13-9-8-10-14-21)31-28(33)22-15-11-12-16-23(22)29(31)34/h8-20,24-25,27H,1-7H3,(H,30,32)/t20-,24-,25+,27-/m0/s1 |
| InChIKey | KAGXYZNVCGGEAB-NIXYAPBQSA-N |
| XLogP | 5.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|