C26H32O4 — CID 101131014
1-(6,12-dihydroxy-11-pentanoyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)pentan-1-one (PubChem CID 101131014) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-(6,12-dihydroxy-11-pentanoyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)pentan-1-one.
| Compound Name | 1-(6,12-dihydroxy-11-pentanoyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)pentan-1-one |
|---|---|
| PubChem CID | 101131014 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-(6,12-dihydroxy-11-pentanoyl-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl)pentan-1-one |
| SMILES | CCCCC(=O)c1c2ccc(c1O)CCc1ccc(c(O)c1C(=O)CCCC)CC2 |
| InChI | InChI=1S/C26H32O4/c1-3-5-7-21(27)23-17-9-13-19(25(23)29)16-12-18-10-14-20(15-11-17)26(30)24(18)22(28)8-6-4-2/h9-10,13-14,29-30H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | PRDYTJNIBIDLGH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |