C29H56O5Si2 — CID 101131247
ethyl 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(E,1S)-1-triethylsilyloxyoct-2-enyl]cyclopentyl]acetate (PubChem CID 101131247) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(E,1S)-1-triethylsilyloxyoct-2-enyl]cyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(E,1S)-1-triethylsilyloxyoct-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 101131247 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | ethyl 2-[(1R,2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(E,1S)-1-triethylsilyloxyoct-2-enyl]cyclopentyl]acetate |
| SMILES | CCCCC/C=C/[C@H](O[Si](CC)(CC)CC)[C@H]1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C29H56O5Si2/c1-11-16-17-18-19-20-25(34-36(13-3,14-4)15-5)28-23(21-27(31)32-12-2)26(22-24(28)30)33-35(9,10)29(6,7)8/h19-20,23,25-26,28H,11-18,21-22H2,1-10H3/b20-19+/t23-,25-,26-,28+/m0/s1 |
| InChIKey | GZSRVUQPYSUURA-UGIHVARGSA-N |
| XLogP | 8.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|