C18H32O4Si — CID 101131253
methyl 2-methyl-2-[(1S,2S)-3-oxo-2-[(E,1R)-1-trimethylsilyloxybut-2-enyl]cyclohexyl]propanoate (PubChem CID 101131253) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is methyl 2-methyl-2-[(1S,2S)-3-oxo-2-[(E,1R)-1-trimethylsilyloxybut-2-enyl]cyclohexyl]propanoate.
| Compound Name | methyl 2-methyl-2-[(1S,2S)-3-oxo-2-[(E,1R)-1-trimethylsilyloxybut-2-enyl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 101131253 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | methyl 2-methyl-2-[(1S,2S)-3-oxo-2-[(E,1R)-1-trimethylsilyloxybut-2-enyl]cyclohexyl]propanoate |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C)[C@H]1C(=O)CCC[C@@H]1C(C)(C)C(=O)OC |
| InChI | InChI=1S/C18H32O4Si/c1-8-10-15(22-23(5,6)7)16-13(11-9-12-14(16)19)18(2,3)17(20)21-4/h8,10,13,15-16H,9,11-12H2,1-7H3/b10-8+/t13-,15+,16+/m0/s1 |
| InChIKey | ASMOAEFFOOVLMC-XXAGSFNLSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|