C19H32O — CID 101131298
[(E)-2-[(1S,2S,3R)-3-ethenyl-2-[(2-methylpropan-2-yl)oxy]cyclopentyl]ethenyl]cyclohexane (PubChem CID 101131298) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is [(E)-2-[(1S,2S,3R)-3-ethenyl-2-[(2-methylpropan-2-yl)oxy]cyclopentyl]ethenyl]cyclohexane.
| Compound Name | [(E)-2-[(1S,2S,3R)-3-ethenyl-2-[(2-methylpropan-2-yl)oxy]cyclopentyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 101131298 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | [(E)-2-[(1S,2S,3R)-3-ethenyl-2-[(2-methylpropan-2-yl)oxy]cyclopentyl]ethenyl]cyclohexane |
| SMILES | C=C[C@H]1CC[C@@H](/C=C/C2CCCCC2)[C@H]1OC(C)(C)C |
| InChI | InChI=1S/C19H32O/c1-5-16-13-14-17(18(16)20-19(2,3)4)12-11-15-9-7-6-8-10-15/h5,11-12,15-18H,1,6-10,13-14H2,2-4H3/b12-11+/t16-,17+,18-/m0/s1 |
| InChIKey | SREXNZIFEVWZTA-ANPJYKQMSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|