C30H57ClO4Si — CID 101131321
[(3Z,7S,8S,9E,11E)-1-chloro-7-methoxy-13-(2-methoxypropan-2-yloxy)-4,8,12-trimethyltrideca-3,9,11-trien-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101131321) has the molecular formula C30H57ClO4Si and a molecular weight of 545.32 g/mol. Its IUPAC name is [(3Z,7S,8S,9E,11E)-1-chloro-7-methoxy-13-(2-methoxypropan-2-yloxy)-4,8,12-trimethyltrideca-3,9,11-trien-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3Z,7S,8S,9E,11E)-1-chloro-7-methoxy-13-(2-methoxypropan-2-yloxy)-4,8,12-trimethyltrideca-3,9,11-trien-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101131321 |
| Molecular Formula | C30H57ClO4Si |
| Molecular Weight | 545.32 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | [(3Z,7S,8S,9E,11E)-1-chloro-7-methoxy-13-(2-methoxypropan-2-yloxy)-4,8,12-trimethyltrideca-3,9,11-trien-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CO[C@@H](CC/C(C)=C\C(CCl)O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C/C=C(\C)COC(C)(C)OC |
| InChI | InChI=1S/C30H57ClO4Si/c1-22(2)36(23(3)4,24(5)6)35-28(20-31)19-25(7)17-18-29(32-12)27(9)16-14-15-26(8)21-34-30(10,11)33-13/h14-16,19,22-24,27-29H,17-18,20-21H2,1-13H3/b16-14+,25-19-,26-15+/t27-,28?,29-/m0/s1 |
| InChIKey | DEBCKJVJGCGEMQ-KUOZBCKWSA-N |
| XLogP | 9.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.32 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|