C24H16N2 — CID 101131434
(1S,6S,10bR)-1-phenyl-2,6-dihydro-1H-aceanthrylene-6,10b-dicarbonitrile (PubChem CID 101131434) has the molecular formula C24H16N2 and a molecular weight of 332.41 g/mol. Its IUPAC name is (1S,6S,10bR)-1-phenyl-2,6-dihydro-1H-aceanthrylene-6,10b-dicarbonitrile.
| Compound Name | (1S,6S,10bR)-1-phenyl-2,6-dihydro-1H-aceanthrylene-6,10b-dicarbonitrile |
|---|---|
| PubChem CID | 101131434 |
| Molecular Formula | C24H16N2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (1S,6S,10bR)-1-phenyl-2,6-dihydro-1H-aceanthrylene-6,10b-dicarbonitrile |
| SMILES | N#C[C@H]1c2ccccc2[C@@]2(C#N)c3c(cccc31)C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H16N2/c25-14-20-18-10-4-5-12-21(18)24(15-26)22(16-7-2-1-3-8-16)13-17-9-6-11-19(20)23(17)24/h1-12,20,22H,13H2/t20-,22-,24+/m0/s1 |
| InChIKey | ASTNYOVYBXFHKN-ODGPQVTHSA-N |
| XLogP | 4.81 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |