C11H16O4 — CID 101131607
methyl (4aS,5S)-5-methyl-2,3,4,4a,5,8a-hexahydropyrano[3,2-c]pyran-7-carboxylate (PubChem CID 101131607) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl (4aS,5S)-5-methyl-2,3,4,4a,5,8a-hexahydropyrano[3,2-c]pyran-7-carboxylate.
| Compound Name | methyl (4aS,5S)-5-methyl-2,3,4,4a,5,8a-hexahydropyrano[3,2-c]pyran-7-carboxylate |
|---|---|
| PubChem CID | 101131607 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl (4aS,5S)-5-methyl-2,3,4,4a,5,8a-hexahydropyrano[3,2-c]pyran-7-carboxylate |
| SMILES | COC(=O)C1=CC2OCCC[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C11H16O4/c1-7-8-4-3-5-14-9(8)6-10(15-7)11(12)13-2/h6-9H,3-5H2,1-2H3/t7-,8-,9?/m0/s1 |
| InChIKey | ZAQITYYDRHCRLX-JVIMKECRSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |