C20H20BrFO10 — CID 101131940
phenacyl (2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate (PubChem CID 101131940) has the molecular formula C20H20BrFO10 and a molecular weight of 519.27 g/mol. Its IUPAC name is phenacyl (2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate.
| Compound Name | phenacyl (2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 101131940 |
| Molecular Formula | C20H20BrFO10 |
| Molecular Weight | 519.27 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | phenacyl (2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-2-bromo-6-fluorooxane-2-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@](Br)(C(=O)OCC(=O)c2ccccc2)O[C@H]1F |
| InChI | InChI=1S/C20H20BrFO10/c1-10(23)29-15-16(30-11(2)24)18(22)32-20(21,17(15)31-12(3)25)19(27)28-9-14(26)13-7-5-4-6-8-13/h4-8,15-18H,9H2,1-3H3/t15-,16-,17+,18-,20+/m1/s1 |
| InChIKey | CXXVZMQRKQJXBF-NUABRCLCSA-N |
| XLogP | 1.62 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|