About 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol
2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol (PubChem CID 101132493) has the molecular formula C8H15N5O3S
and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol |
| PubChem CID | 101132493 |
| Molecular Formula | C8H15N5O3S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol |
| SMILES | O=[N+]([O-])C1=CNC(NC2NCCN2CCO)S1 |
| InChI | InChI=1S/C8H15N5O3S/c14-4-3-12-2-1-9-7(12)11-8-10-5-6(17-8)13(15)16/h5,7-11,14H,1-4H2 |
| InChIKey | GTCUCOQTTJAIOA-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol?
The IUPAC name of 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol (CID 101132493) is 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol.
What is the SMILES notation for 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol?
The canonical SMILES for 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol is O=[N+]([O-])C1=CNC(NC2NCCN2CCO)S1.
What is the InChIKey of 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol?
The InChIKey is GTCUCOQTTJAIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5O3S/c14-4-3-12-2-1-9-7(12)11-8-10-5-6(17-8)13(15)16/h5,7-11,14H,1-4H2.
What are the key properties of 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol?
2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol has a molecular weight of 261.31 g/mol, XLogP of -1.55, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(5-nitro-2,3-dihydro-1,3-thiazol-2-yl)amino]imidazolidin-1-yl]ethanol is sourced from PubChem (CID 101132493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).