C16H22O3 — CID 101132756
(2S,4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxane (PubChem CID 101132756) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2S,4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxane.
| Compound Name | (2S,4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 101132756 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (2S,4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-1,3-dioxane |
| SMILES | C=C[C@H]1O[C@@H](Cc2ccc(OC)cc2)OCC1(C)C |
| InChI | InChI=1S/C16H22O3/c1-5-14-16(2,3)11-18-15(19-14)10-12-6-8-13(17-4)9-7-12/h5-9,14-15H,1,10-11H2,2-4H3/t14-,15+/m1/s1 |
| InChIKey | IJDCKJBAMYSUHF-CABCVRRESA-N |
| XLogP | 3.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|