About (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one
(10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one (PubChem CID 101132842) has the molecular formula C21H15NO2
and a molecular weight of 313.36 g/mol. Its IUPAC name is (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one.
Molecular Properties
| Compound Name | (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one |
| PubChem CID | 101132842 |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one |
| SMILES | O=C1c2ccccc2[C@]2(O)[C@@H](c3ccccc3)c3ccccc3N12 |
| InChI | InChI=1S/C21H15NO2/c23-20-15-10-4-6-12-17(15)21(24)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)22(20)21/h1-13,19,24H/t19-,21-/m0/s1 |
| InChIKey | BYRJRRUFPZNQDP-FPOVZHCZSA-N |
| XLogP | 3.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one?
The IUPAC name of (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one (CID 101132842) is (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one.
What is the SMILES notation for (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one?
The canonical SMILES for (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one is O=C1c2ccccc2[C@]2(O)[C@@H](c3ccccc3)c3ccccc3N12.
What is the InChIKey of (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one?
The InChIKey is BYRJRRUFPZNQDP-FPOVZHCZSA-N. The full InChI is InChI=1S/C21H15NO2/c23-20-15-10-4-6-12-17(15)21(24)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)22(20)21/h1-13,19,24H/t19-,21-/m0/s1.
What are the key properties of (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one?
(10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one has a molecular weight of 313.36 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10bR,11S)-10b-hydroxy-11-phenyl-11H-isoindolo[2,1-a]indol-6-one is sourced from PubChem (CID 101132842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).