About (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide
(3-acetylcyclohexa-2,4-dien-1-ylidene)azanide (PubChem CID 101133413) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide.
Molecular Properties
| Compound Name | (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide |
| PubChem CID | 101133413 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide |
| SMILES | CC(=O)C1=CC(=[N-])[CH+]C=C1 |
| InChI | InChI=1S/C8H7NO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3 |
| InChIKey | AQQWNIWZSCPMEA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide?
The IUPAC name of (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide (CID 101133413) is (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide.
What is the SMILES notation for (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide?
The canonical SMILES for (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide is CC(=O)C1=CC(=[N-])[CH+]C=C1.
What is the InChIKey of (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide?
The InChIKey is AQQWNIWZSCPMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3.
What are the key properties of (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide?
(3-acetylcyclohexa-2,4-dien-1-ylidene)azanide has a molecular weight of 133.15 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylcyclohexa-2,4-dien-1-ylidene)azanide is sourced from PubChem (CID 101133413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).