C14H22O5 — CID 101133580
(2S,3S,4aR,8aR)-6-ethyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one (PubChem CID 101133580) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (2S,3S,4aR,8aR)-6-ethyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one.
| Compound Name | (2S,3S,4aR,8aR)-6-ethyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one |
|---|---|
| PubChem CID | 101133580 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2S,3S,4aR,8aR)-6-ethyl-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-7-one |
| SMILES | CCC1=C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2CC1=O |
| InChI | InChI=1S/C14H22O5/c1-6-9-7-11-12(8-10(9)15)19-14(3,17-5)13(2,16-4)18-11/h7,11-12H,6,8H2,1-5H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | WBECFDLMYICACO-MQYQWHSLSA-N |
| XLogP | 1.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |