About (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol
(1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol (PubChem CID 101134322) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol |
| PubChem CID | 101134322 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol |
| SMILES | CC(C)[C@@H](O)C1(C(C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C14H28O3/c1-10(2)11(15)14(12(3,4)5)8-16-13(6,7)17-9-14/h10-11,15H,8-9H2,1-7H3/t11-/m1/s1 |
| InChIKey | FSUIBEKIEAAUAW-LLVKDONJSA-N |
| XLogP | 2.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol?
The IUPAC name of (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol (CID 101134322) is (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol.
What is the SMILES notation for (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol?
The canonical SMILES for (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol is CC(C)[C@@H](O)C1(C(C)(C)C)COC(C)(C)OC1.
What is the InChIKey of (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol?
The InChIKey is FSUIBEKIEAAUAW-LLVKDONJSA-N. The full InChI is InChI=1S/C14H28O3/c1-10(2)11(15)14(12(3,4)5)8-16-13(6,7)17-9-14/h10-11,15H,8-9H2,1-7H3/t11-/m1/s1.
What are the key properties of (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol?
(1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol has a molecular weight of 244.37 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(5-tert-butyl-2,2-dimethyl-1,3-dioxan-5-yl)-2-methylpropan-1-ol is sourced from PubChem (CID 101134322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).