About N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide
N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide (PubChem CID 101134355) has the molecular formula C20H24N2O3
and a molecular weight of 340.42 g/mol. Its IUPAC name is N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide |
| PubChem CID | 101134355 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2cccc(O)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-13-9-14(2)11-16(10-13)19(25)22(20(3,4)5)21-18(24)15-7-6-8-17(23)12-15/h6-12,23H,1-5H3,(H,21,24) |
| InChIKey | BIYVUUDCQDRCDP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide?
The IUPAC name of N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide (CID 101134355) is N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide.
What is the SMILES notation for N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide?
The canonical SMILES for N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide is Cc1cc(C)cc(C(=O)N(NC(=O)c2cccc(O)c2)C(C)(C)C)c1.
What is the InChIKey of N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide?
The InChIKey is BIYVUUDCQDRCDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3/c1-13-9-14(2)11-16(10-13)19(25)22(20(3,4)5)21-18(24)15-7-6-8-17(23)12-15/h6-12,23H,1-5H3,(H,21,24).
What are the key properties of N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide?
N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide has a molecular weight of 340.42 g/mol, XLogP of 3.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(3-hydroxybenzoyl)-3,5-dimethylbenzohydrazide is sourced from PubChem (CID 101134355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).