About N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide
N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide (PubChem CID 101134356) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide |
| PubChem CID | 101134356 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide |
| SMILES | CCOc1cccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-7-27-19-10-8-9-17(14-19)20(25)23-24(22(4,5)6)21(26)18-12-15(2)11-16(3)13-18/h8-14H,7H2,1-6H3,(H,23,25) |
| InChIKey | MZKUTFSSIFVTKY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide?
The IUPAC name of N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide (CID 101134356) is N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide.
What is the SMILES notation for N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide?
The canonical SMILES for N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide is CCOc1cccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1.
What is the InChIKey of N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide?
The InChIKey is MZKUTFSSIFVTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-7-27-19-10-8-9-17(14-19)20(25)23-24(22(4,5)6)21(26)18-12-15(2)11-16(3)13-18/h8-14H,7H2,1-6H3,(H,23,25).
What are the key properties of N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide?
N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide has a molecular weight of 368.48 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(3-ethoxybenzoyl)-3,5-dimethylbenzohydrazide is sourced from PubChem (CID 101134356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).