C14H18O — CID 101134635
cis-(2S,3S)-3-tert-butyl-2-phenylcyclobutan-1-one (PubChem CID 101134635) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is cis-(2S,3S)-3-tert-butyl-2-phenylcyclobutan-1-one.
| Compound Name | cis-(2S,3S)-3-tert-butyl-2-phenylcyclobutan-1-one |
|---|---|
| PubChem CID | 101134635 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | cis-(2S,3S)-3-tert-butyl-2-phenylcyclobutan-1-one |
| SMILES | CC(C)(C)[C@H]1CC(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-14(2,3)11-9-12(15)13(11)10-7-5-4-6-8-10/h4-8,11,13H,9H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | SOBITUOYWZFHRP-WCQYABFASA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |